C20H15Cl2F3N2O5 — CID 4831951
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 4831951) has the molecular formula C20H15Cl2F3N2O5 and a molecular weight of 491.25 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4831951 |
| Molecular Formula | C20H15Cl2F3N2O5 |
| Molecular Weight | 491.25 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C20H15Cl2F3N2O5/c1-31-4-5-32-16-3-2-10(20(23,24)25)6-15(16)26-17(28)9-27-18(29)11-7-13(21)14(22)8-12(11)19(27)30/h2-3,6-8H,4-5,9H2,1H3,(H,26,28) |
| InChIKey | YQVAFWCKNIINEV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|