C16H16F3N3O3 — CID 17439153
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-5-methylpyrazine-2-carboxamide (PubChem CID 17439153) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 17439153 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-5-methylpyrazine-2-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cnc(C)cn1 |
| InChI | InChI=1S/C16H16F3N3O3/c1-10-8-21-13(9-20-10)15(23)22-12-7-11(16(17,18)19)3-4-14(12)25-6-5-24-2/h3-4,7-9H,5-6H2,1-2H3,(H,22,23) |
| InChIKey | CIGQQZYMGXSKLU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|