C17H18F3NO3S — CID 78777792
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4,5-dimethylthiophene-2-carboxamide (PubChem CID 78777792) has the molecular formula C17H18F3NO3S and a molecular weight of 373.40 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 78777792 |
| Molecular Formula | C17H18F3NO3S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-4,5-dimethylthiophene-2-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cc(C)c(C)s1 |
| InChI | InChI=1S/C17H18F3NO3S/c1-10-8-15(25-11(10)2)16(22)21-13-9-12(17(18,19)20)4-5-14(13)24-7-6-23-3/h4-5,8-9H,6-7H2,1-3H3,(H,21,22) |
| InChIKey | QMRILDZXNVAHSD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|