C19H20F3NO3S — CID 55532465
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-methyl-5-methylsulfanylbenzamide (PubChem CID 55532465) has the molecular formula C19H20F3NO3S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-methyl-5-methylsulfanylbenzamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-methyl-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 55532465 |
| Molecular Formula | C19H20F3NO3S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-methyl-5-methylsulfanylbenzamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cc(SC)ccc1C |
| InChI | InChI=1S/C19H20F3NO3S/c1-12-4-6-14(27-3)11-15(12)18(24)23-16-10-13(19(20,21)22)5-7-17(16)26-9-8-25-2/h4-7,10-11H,8-9H2,1-3H3,(H,23,24) |
| InChIKey | BECLPTWSEXJTAN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|