C20H16F3NO5 — CID 9268804
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-oxochromene-3-carboxamide (PubChem CID 9268804) has the molecular formula C20H16F3NO5 and a molecular weight of 407.34 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 9268804 |
| Molecular Formula | C20H16F3NO5 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-oxochromene-3-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C20H16F3NO5/c1-27-8-9-28-17-7-6-13(20(21,22)23)11-15(17)24-18(25)14-10-12-4-2-3-5-16(12)29-19(14)26/h2-7,10-11H,8-9H2,1H3,(H,24,25) |
| InChIKey | XCWAMSWVDYFRRY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|