C22H21F3N2O3 — CID 55466432
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2,6-dimethylquinoline-3-carboxamide (PubChem CID 55466432) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2,6-dimethylquinoline-3-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2,6-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 55466432 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2,6-dimethylquinoline-3-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cc2cc(C)ccc2nc1C |
| InChI | InChI=1S/C22H21F3N2O3/c1-13-4-6-18-15(10-13)11-17(14(2)26-18)21(28)27-19-12-16(22(23,24)25)5-7-20(19)30-9-8-29-3/h4-7,10-12H,8-9H2,1-3H3,(H,27,28) |
| InChIKey | FZSAXQRZHUICNK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|