C25H23F3N4O3 — CID 17417002
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 17417002) has the molecular formula C25H23F3N4O3 and a molecular weight of 484.48 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 17417002 |
| Molecular Formula | C25H23F3N4O3 |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-dimethyl-6-phenylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cc(-c2ccccc2)nc2c1c(C)nn2C |
| InChI | InChI=1S/C25H23F3N4O3/c1-15-22-18(14-19(16-7-5-4-6-8-16)29-23(22)32(2)31-15)24(33)30-20-13-17(25(26,27)28)9-10-21(20)35-12-11-34-3/h4-10,13-14H,11-12H2,1-3H3,(H,30,33) |
| InChIKey | ZJKZYROZVCMYSV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|