C26H22F3N3O3 — CID 16549700
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-diphenylpyrazole-5-carboxamide (PubChem CID 16549700) has the molecular formula C26H22F3N3O3 and a molecular weight of 481.47 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-diphenylpyrazole-5-carboxamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-diphenylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 16549700 |
| Molecular Formula | C26H22F3N3O3 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-1,3-diphenylpyrazole-5-carboxamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)c1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C26H22F3N3O3/c1-34-14-15-35-24-13-12-19(26(27,28)29)16-22(24)30-25(33)23-17-21(18-8-4-2-5-9-18)31-32(23)20-10-6-3-7-11-20/h2-13,16-17H,14-15H2,1H3,(H,30,33) |
| InChIKey | NVQNTAAYIKTJQS-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|