C20H18F3N3O4 — CID 16549697
N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide (PubChem CID 16549697) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 16549697 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-2-(2-oxoquinoxalin-1-yl)acetamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)Cn1c(=O)cnc2ccccc21 |
| InChI | InChI=1S/C20H18F3N3O4/c1-29-8-9-30-17-7-6-13(20(21,22)23)10-15(17)25-18(27)12-26-16-5-3-2-4-14(16)24-11-19(26)28/h2-7,10-11H,8-9,12H2,1H3,(H,25,27) |
| InChIKey | CHJQYWKHLPDZLJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|