C21H18F3N3O3 — CID 26177460
(E)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide (PubChem CID 26177460) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is (E)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 26177460 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | (E)-N-[2-(2-methoxyethoxy)-5-(trifluoromethyl)phenyl]-3-quinoxalin-2-ylprop-2-enamide |
| SMILES | COCCOc1ccc(C(F)(F)F)cc1NC(=O)/C=C/c1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H18F3N3O3/c1-29-10-11-30-19-8-6-14(21(22,23)24)12-18(19)27-20(28)9-7-15-13-25-16-4-2-3-5-17(16)26-15/h2-9,12-13H,10-11H2,1H3,(H,27,28)/b9-7+ |
| InChIKey | XHPIRIAAQUPRBK-VQHVLOKHSA-N |
| XLogP | 4.33 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|