C21H13F6N3O3 — CID 2508704
[2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate (PubChem CID 2508704) has the molecular formula C21H13F6N3O3 and a molecular weight of 469.34 g/mol. Its IUPAC name is [2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate.
| Compound Name | [2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2508704 |
| Molecular Formula | C21H13F6N3O3 |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | [2-[3,5-bis(trifluoromethyl)anilino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cnc2ccccc2n1)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H13F6N3O3/c22-20(23,24)12-7-13(21(25,26)27)9-15(8-12)30-18(31)11-33-19(32)6-5-14-10-28-16-3-1-2-4-17(16)29-14/h1-10H,11H2,(H,30,31)/b6-5+ |
| InChIKey | VWFIMPMQEBKPRX-AATRIKPKSA-N |
| XLogP | 4.86 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|