C22H21N3O3 — CID 18270385
[2-[benzyl(ethyl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate (PubChem CID 18270385) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate.
| Compound Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 18270385 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
| SMILES | CCN(Cc1ccccc1)C(=O)COC(=O)/C=C/c1cnc2ccccc2n1 |
| InChI | InChI=1S/C22H21N3O3/c1-2-25(15-17-8-4-3-5-9-17)21(26)16-28-22(27)13-12-18-14-23-19-10-6-7-11-20(19)24-18/h3-14H,2,15-16H2,1H3/b13-12+ |
| InChIKey | BKVWNMLLTBHHBV-OUKQBFOZSA-N |
| XLogP | 3.23 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|