C18H19N3O5S — CID 6591501
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate (PubChem CID 6591501) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 6591501 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
| SMILES | CN(C(=O)COC(=O)/C=C/c1cnc2ccccc2n1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H19N3O5S/c1-21(14-8-9-27(24,25)12-14)17(22)11-26-18(23)7-6-13-10-19-15-4-2-3-5-16(15)20-13/h2-7,10,14H,8-9,11-12H2,1H3/b7-6+/t14-/m0/s1 |
| InChIKey | QINWNTVNKYUASL-UZYOAWRESA-N |
| XLogP | 0.83 |
| TPSA | 106.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|