C17H18ClNO7S — CID 8661143
[2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8661143) has the molecular formula C17H18ClNO7S and a molecular weight of 415.85 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8661143 |
| Molecular Formula | C17H18ClNO7S |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CN(C(=O)COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18ClNO7S/c1-19(12-4-5-27(22,23)9-12)15(20)8-24-16(21)3-2-11-6-13(18)17-14(7-11)25-10-26-17/h2-3,6-7,12H,4-5,8-10H2,1H3/b3-2+/t12-/m0/s1 |
| InChIKey | QSXUWWKSGIMIGL-JDGPPOGSSA-N |
| XLogP | 1.27 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|