C18H23NO7S — CID 7787935
[2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 7787935) has the molecular formula C18H23NO7S and a molecular weight of 397.45 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7787935 |
| Molecular Formula | C18H23NO7S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)N(C)[C@@H]2CCS(=O)(=O)C2)c(OC)c1 |
| InChI | InChI=1S/C18H23NO7S/c1-19(14-8-9-27(22,23)12-14)17(20)11-26-18(21)7-5-13-4-6-15(24-2)10-16(13)25-3/h4-7,10,14H,8-9,11-12H2,1-3H3/b7-5+/t14-/m1/s1 |
| InChIKey | QHPWTCKKWAALPQ-HZRUHFOJSA-N |
| XLogP | 0.91 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|