C20H25NO7S — CID 9417038
[2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 9417038) has the molecular formula C20H25NO7S and a molecular weight of 423.49 g/mol. Its IUPAC name is [2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9417038 |
| Molecular Formula | C20H25NO7S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [2-[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)N(C2CC2)[C@@H]2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C20H25NO7S/c1-26-17-7-3-14(11-18(17)27-2)4-8-20(23)28-12-19(22)21(15-5-6-15)16-9-10-29(24,25)13-16/h3-4,7-8,11,15-16H,5-6,9-10,12-13H2,1-2H3/b8-4+/t16-/m1/s1 |
| InChIKey | GUMPGPBXGSZXGO-KZJSRBBCSA-N |
| XLogP | 1.44 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|