C23H33NO7S — CID 75458942
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (E)-3-[3-ethoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate (PubChem CID 75458942) has the molecular formula C23H33NO7S and a molecular weight of 467.58 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (E)-3-[3-ethoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (E)-3-[3-ethoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 75458942 |
| Molecular Formula | C23H33NO7S |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] (E)-3-[3-ethoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)N(CC)C2CCS(=O)(=O)C2)ccc1OCC(C)C |
| InChI | InChI=1S/C23H33NO7S/c1-5-24(19-11-12-32(27,28)16-19)22(25)15-31-23(26)10-8-18-7-9-20(30-14-17(3)4)21(13-18)29-6-2/h7-10,13,17,19H,5-6,11-12,14-16H2,1-4H3/b10-8+ |
| InChIKey | IKEBIKXLLDXGJW-CSKARUKUSA-N |
| XLogP | 2.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|