C18H20F3NO6S — CID 32820565
[2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate (PubChem CID 32820565) has the molecular formula C18H20F3NO6S and a molecular weight of 435.42 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 32820565 |
| Molecular Formula | C18H20F3NO6S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] (E)-3-[4-(trifluoromethoxy)phenyl]prop-2-enoate |
| SMILES | CCN(C(=O)COC(=O)/C=C/c1ccc(OC(F)(F)F)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20F3NO6S/c1-2-22(14-9-10-29(25,26)12-14)16(23)11-27-17(24)8-5-13-3-6-15(7-4-13)28-18(19,20)21/h3-8,14H,2,9-12H2,1H3/b8-5+/t14-/m0/s1 |
| InChIKey | GHJATYXDOXYBJR-GPAKFWEMSA-N |
| XLogP | 2.18 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|