C19H24ClNO5S — CID 7868020
[2-[[(3S)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 7868020) has the molecular formula C19H24ClNO5S and a molecular weight of 413.92 g/mol. Its IUPAC name is [2-[[(3S)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7868020 |
| Molecular Formula | C19H24ClNO5S |
| Molecular Weight | 413.92 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-[[(3S)-1,1-dioxothiolan-3-yl]-(2-methylpropyl)amino]-2-oxoethyl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | CC(C)CN(C(=O)COC(=O)/C=C/c1ccc(Cl)cc1)[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H24ClNO5S/c1-14(2)11-21(17-9-10-27(24,25)13-17)18(22)12-26-19(23)8-5-15-3-6-16(20)7-4-15/h3-8,14,17H,9-13H2,1-2H3/b8-5+/t17-/m0/s1 |
| InChIKey | KHMLAHJFCJGTEE-JZLODUJNSA-N |
| XLogP | 2.57 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.92 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|