C17H22FNO3S — CID 6224010
(E)-N-(1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 6224010) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is (E)-N-(1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 6224010 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (E)-N-(1,1-dioxothiolan-3-yl)-3-(4-fluorophenyl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | CC(C)CN(C(=O)/C=C/c1ccc(F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H22FNO3S/c1-13(2)11-19(16-9-10-23(21,22)12-16)17(20)8-5-14-3-6-15(18)7-4-14/h3-8,13,16H,9-12H2,1-2H3/b8-5+ |
| InChIKey | AOIDAJPXAKMHGU-VMPITWQZSA-N |
| XLogP | 2.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|