C18H25NO4S — CID 7260080
(E)-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 7260080) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is (E)-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | (E)-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 7260080 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (E)-N-[(3R)-1,1-dioxothiolan-3-yl]-3-(4-methoxyphenyl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N(CC(C)C)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C18H25NO4S/c1-14(2)12-19(16-10-11-24(21,22)13-16)18(20)9-6-15-4-7-17(23-3)8-5-15/h4-9,14,16H,10-13H2,1-3H3/b9-6+/t16-/m1/s1 |
| InChIKey | KEVANGKAHCYNTL-YXMGTMDOSA-N |
| XLogP | 2.38 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|