C17H21F2NO4S — CID 78771470
3-[4-(difluoromethoxy)phenyl]-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide (PubChem CID 78771470) has the molecular formula C17H21F2NO4S and a molecular weight of 373.42 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 78771470 |
| Molecular Formula | C17H21F2NO4S |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-N-(1,1-dioxothiolan-3-yl)-N-propylprop-2-enamide |
| SMILES | CCCN(C(=O)C=Cc1ccc(OC(F)F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21F2NO4S/c1-2-10-20(14-9-11-25(22,23)12-14)16(21)8-5-13-3-6-15(7-4-13)24-17(18)19/h3-8,14,17H,2,9-12H2,1H3 |
| InChIKey | QLOJOKIDCHYNTI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|