C16H20F2N2O4S — CID 39967572
(E)-3-[4-(difluoromethoxy)phenyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethylprop-2-enehydrazide (PubChem CID 39967572) has the molecular formula C16H20F2N2O4S and a molecular weight of 374.41 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethylprop-2-enehydrazide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethylprop-2-enehydrazide |
|---|---|
| PubChem CID | 39967572 |
| Molecular Formula | C16H20F2N2O4S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethylprop-2-enehydrazide |
| SMILES | CN(C)N(C(=O)/C=C/c1ccc(OC(F)F)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H20F2N2O4S/c1-19(2)20(13-9-10-25(22,23)11-13)15(21)8-5-12-3-6-14(7-4-12)24-16(17)18/h3-8,13,16H,9-11H2,1-2H3/b8-5+/t13-/m1/s1 |
| InChIKey | GWCYFKKSHGKTKX-OQHXTRMZSA-N |
| XLogP | 1.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|