C18H26N2O6S — CID 7614597
(E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide (PubChem CID 7614597) has the molecular formula C18H26N2O6S and a molecular weight of 398.48 g/mol. Its IUPAC name is (E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide.
| Compound Name | (E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide |
|---|---|
| PubChem CID | 7614597 |
| Molecular Formula | C18H26N2O6S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (E)-N-[(3R)-1,1-dioxothiolan-3-yl]-N',N'-dimethyl-3-(3,4,5-trimethoxyphenyl)prop-2-enehydrazide |
| SMILES | COc1cc(/C=C/C(=O)N([C@@H]2CCS(=O)(=O)C2)N(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C18H26N2O6S/c1-19(2)20(14-8-9-27(22,23)12-14)17(21)7-6-13-10-15(24-3)18(26-5)16(11-13)25-4/h6-7,10-11,14H,8-9,12H2,1-5H3/b7-6+/t14-/m1/s1 |
| InChIKey | VWIYFQKDKHYVDO-PSKZRQQASA-N |
| XLogP | 1.22 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|