C38H50N2O8 — CID 18518210
(2E,4E)-N-methyl-N-[[4-[[methyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]methyl]cyclohexyl]methyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide (PubChem CID 18518210) has the molecular formula C38H50N2O8 and a molecular weight of 662.82 g/mol. Its IUPAC name is (2E,4E)-N-methyl-N-[[4-[[methyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]methyl]cyclohexyl]methyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N-methyl-N-[[4-[[methyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]methyl]cyclohexyl]methyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 18518210 |
| Molecular Formula | C38H50N2O8 |
| Molecular Weight | 662.82 g/mol |
| Exact Mass | 662.36 |
| IUPAC Name | (2E,4E)-N-methyl-N-[[4-[[methyl-[(2E,4E)-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienoyl]amino]methyl]cyclohexyl]methyl]-5-(3,4,5-trimethoxyphenyl)penta-2,4-dienamide |
| SMILES | COc1cc(/C=C/C=C/C(=O)N(C)CC2CCC(CN(C)C(=O)/C=C/C=C/c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C38H50N2O8/c1-39(35(41)15-11-9-13-29-21-31(43-3)37(47-7)32(22-29)44-4)25-27-17-19-28(20-18-27)26-40(2)36(42)16-12-10-14-30-23-33(45-5)38(48-8)34(24-30)46-6/h9-16,21-24,27-28H,17-20,25-26H2,1-8H3/b13-9+,14-10+,15-11+,16-12+ |
| InChIKey | LFKTXIJRWPBYBQ-KUWVSJDVSA-N |
| XLogP | 6.30 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.82 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|