C19H27NO3 — CID 55564274
(E)-N-(cyclohexylmethyl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide (PubChem CID 55564274) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is (E)-N-(cyclohexylmethyl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(cyclohexylmethyl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 55564274 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (E)-N-(cyclohexylmethyl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)CC2CCCCC2)cc(OC)c1 |
| InChI | InChI=1S/C19H27NO3/c1-20(14-15-7-5-4-6-8-15)19(21)10-9-16-11-17(22-2)13-18(12-16)23-3/h9-13,15H,4-8,14H2,1-3H3/b10-9+ |
| InChIKey | OYMMVVCDPSRDJZ-MDZDMXLPSA-N |
| XLogP | 3.76 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|