C16H20N2O3 — CID 56825639
(E)-N-(1-cyanopropan-2-yl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide (PubChem CID 56825639) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (E)-N-(1-cyanopropan-2-yl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1-cyanopropan-2-yl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 56825639 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (E)-N-(1-cyanopropan-2-yl)-3-(3,5-dimethoxyphenyl)-N-methylprop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)C(C)CC#N)cc(OC)c1 |
| InChI | InChI=1S/C16H20N2O3/c1-12(7-8-17)18(2)16(19)6-5-13-9-14(20-3)11-15(10-13)21-4/h5-6,9-12H,7H2,1-4H3/b6-5+ |
| InChIKey | OARRLRKNWRYKAX-AATRIKPKSA-N |
| XLogP | 2.48 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|