C21H25NO5S — CID 42946005
(E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide (PubChem CID 42946005) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 42946005 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N-methyl-N-[1-(4-methylsulfonylphenyl)ethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N(C)C(C)c2ccc(S(C)(=O)=O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C21H25NO5S/c1-15(17-7-9-20(10-8-17)28(5,24)25)22(2)21(23)11-6-16-12-18(26-3)14-19(13-16)27-4/h6-15H,1-5H3/b11-6+ |
| InChIKey | DGZPQJAWHJMORF-IZZDOVSWSA-N |
| XLogP | 3.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|