C20H23N3O — CID 56523462
(E)-N-(1-cyanopropan-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylprop-2-enamide (PubChem CID 56523462) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-N-(1-cyanopropan-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylprop-2-enamide.
| Compound Name | (E)-N-(1-cyanopropan-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 56523462 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | (E)-N-(1-cyanopropan-2-yl)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-N-methylprop-2-enamide |
| SMILES | Cc1cc(/C=C/C(=O)N(C)C(C)CC#N)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C20H23N3O/c1-15(12-13-21)22(4)20(24)11-10-18-14-16(2)23(17(18)3)19-8-6-5-7-9-19/h5-11,14-15H,12H2,1-4H3/b11-10+ |
| InChIKey | OUWQNOWEISYSIE-ZHACJKMWSA-N |
| XLogP | 3.87 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|