C25H29N3O3S — CID 46635360
(E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]prop-2-enamide (PubChem CID 46635360) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 46635360 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-methyl-N-[1-(4-sulfamoylphenyl)ethyl]prop-2-enamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C/C(=O)N(C)C(C)c3ccc(S(N)(=O)=O)cc3)c2C)cc1 |
| InChI | InChI=1S/C25H29N3O3S/c1-17-6-11-23(12-7-17)28-18(2)16-22(20(28)4)10-15-25(29)27(5)19(3)21-8-13-24(14-9-21)32(26,30)31/h6-16,19H,1-5H3,(H2,26,30,31)/b15-10+ |
| InChIKey | SGPYUDIAVAKLLP-XNTDXEJSSA-N |
| XLogP | 4.28 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|