C24H25N3O4S — CID 34966987
N'-[(E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]-4-methylsulfonylbenzohydrazide (PubChem CID 34966987) has the molecular formula C24H25N3O4S and a molecular weight of 451.55 g/mol. Its IUPAC name is N'-[(E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]-4-methylsulfonylbenzohydrazide.
| Compound Name | N'-[(E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]-4-methylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 34966987 |
| Molecular Formula | C24H25N3O4S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | N'-[(E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]-4-methylsulfonylbenzohydrazide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C/C(=O)NNC(=O)c3ccc(S(C)(=O)=O)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H25N3O4S/c1-16-5-10-21(11-6-16)27-17(2)15-20(18(27)3)9-14-23(28)25-26-24(29)19-7-12-22(13-8-19)32(4,30)31/h5-15H,1-4H3,(H,25,28)(H,26,29)/b14-9+ |
| InChIKey | MNUQEYUDZCZPAI-NTEUORMPSA-N |
| XLogP | 3.28 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|