About 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide
1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide (PubChem CID 52711613) has the molecular formula C21H20ClN3O4S
and a molecular weight of 445.93 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide |
| PubChem CID | 52711613 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccc(S(C)(=O)=O)cc2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClN3O4S/c1-13-12-19(14(2)25(13)17-8-6-16(22)7-9-17)21(27)24-23-20(26)15-4-10-18(11-5-15)30(3,28)29/h4-12H,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | KPADDPQBPWAVSF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide?
The IUPAC name of 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide (CID 52711613) is 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide.
What is the SMILES notation for 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide?
The canonical SMILES for 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide is Cc1cc(C(=O)NNC(=O)c2ccc(S(C)(=O)=O)cc2)c(C)n1-c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide?
The InChIKey is KPADDPQBPWAVSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClN3O4S/c1-13-12-19(14(2)25(13)17-8-6-16(22)7-9-17)21(27)24-23-20(26)15-4-10-18(11-5-15)30(3,28)29/h4-12H,1-3H3,(H,23,26)(H,24,27).
What are the key properties of 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide?
1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide has a molecular weight of 445.93 g/mol, XLogP of 3.23, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2,5-dimethyl-N'-(4-methylsulfonylbenzoyl)pyrrole-3-carbohydrazide is sourced from PubChem (CID 52711613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).