C19H17ClFN3O3S — CID 26980835
N'-(3-chloro-4-fluorophenyl)sulfonyl-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 26980835) has the molecular formula C19H17ClFN3O3S and a molecular weight of 421.88 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)sulfonyl-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 26980835 |
| Molecular Formula | C19H17ClFN3O3S |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-2,5-dimethyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNS(=O)(=O)c2ccc(F)c(Cl)c2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C19H17ClFN3O3S/c1-12-10-16(13(2)24(12)14-6-4-3-5-7-14)19(25)22-23-28(26,27)15-8-9-18(21)17(20)11-15/h3-11,23H,1-2H3,(H,22,25) |
| InChIKey | VEXAJMRPZMXYDB-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|