C21H21N3O3S — CID 8505015
2,5-dimethyl-1-phenyl-N'-[(E)-2-phenylethenyl]sulfonylpyrrole-3-carbohydrazide (PubChem CID 8505015) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2,5-dimethyl-1-phenyl-N'-[(E)-2-phenylethenyl]sulfonylpyrrole-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-1-phenyl-N'-[(E)-2-phenylethenyl]sulfonylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 8505015 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2,5-dimethyl-1-phenyl-N'-[(E)-2-phenylethenyl]sulfonylpyrrole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNS(=O)(=O)/C=C/c2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-16-15-20(17(2)24(16)19-11-7-4-8-12-19)21(25)22-23-28(26,27)14-13-18-9-5-3-6-10-18/h3-15,23H,1-2H3,(H,22,25)/b14-13+ |
| InChIKey | RUPPEYJUNFPWCC-BUHFOSPRSA-N |
| XLogP | 3.33 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|