C23H22N4O3S — CID 31046524
2,5-dimethyl-N'-(3-methylquinolin-8-yl)sulfonyl-1-phenylpyrrole-3-carbohydrazide (PubChem CID 31046524) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2,5-dimethyl-N'-(3-methylquinolin-8-yl)sulfonyl-1-phenylpyrrole-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-(3-methylquinolin-8-yl)sulfonyl-1-phenylpyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 31046524 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2,5-dimethyl-N'-(3-methylquinolin-8-yl)sulfonyl-1-phenylpyrrole-3-carbohydrazide |
| SMILES | Cc1cnc2c(S(=O)(=O)NNC(=O)c3cc(C)n(-c4ccccc4)c3C)cccc2c1 |
| InChI | InChI=1S/C23H22N4O3S/c1-15-12-18-8-7-11-21(22(18)24-14-15)31(29,30)26-25-23(28)20-13-16(2)27(17(20)3)19-9-5-4-6-10-19/h4-14,26H,1-3H3,(H,25,28) |
| InChIKey | BSABGVKJDIHZPX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|