C14H11ClF2N2O3S — CID 170607681
4-chloro-2,6-difluoro-N'-(4-methylphenyl)sulfonylbenzohydrazide (PubChem CID 170607681) has the molecular formula C14H11ClF2N2O3S and a molecular weight of 360.77 g/mol. Its IUPAC name is 4-chloro-2,6-difluoro-N'-(4-methylphenyl)sulfonylbenzohydrazide.
| Compound Name | 4-chloro-2,6-difluoro-N'-(4-methylphenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 170607681 |
| Molecular Formula | C14H11ClF2N2O3S |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 4-chloro-2,6-difluoro-N'-(4-methylphenyl)sulfonylbenzohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)c2c(F)cc(Cl)cc2F)cc1 |
| InChI | InChI=1S/C14H11ClF2N2O3S/c1-8-2-4-10(5-3-8)23(21,22)19-18-14(20)13-11(16)6-9(15)7-12(13)17/h2-7,19H,1H3,(H,18,20) |
| InChIKey | MOBWKXQQDSZLHZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|