C15H15ClN2O5S2 — CID 146673637
2-(4-chlorophenyl)sulfonyl-N'-(4-methylphenyl)sulfonylacetohydrazide (PubChem CID 146673637) has the molecular formula C15H15ClN2O5S2 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-N'-(4-methylphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-N'-(4-methylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 146673637 |
| Molecular Formula | C15H15ClN2O5S2 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-N'-(4-methylphenyl)sulfonylacetohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)CS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H15ClN2O5S2/c1-11-2-6-14(7-3-11)25(22,23)18-17-15(19)10-24(20,21)13-8-4-12(16)5-9-13/h2-9,18H,10H2,1H3,(H,17,19) |
| InChIKey | KDVLTUAQHXZDIH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|