C13H20N2O5S2 — CID 146673615
N'-butylsulfonyl-2-(4-methylphenyl)sulfonylacetohydrazide (PubChem CID 146673615) has the molecular formula C13H20N2O5S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N'-butylsulfonyl-2-(4-methylphenyl)sulfonylacetohydrazide.
| Compound Name | N'-butylsulfonyl-2-(4-methylphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 146673615 |
| Molecular Formula | C13H20N2O5S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N'-butylsulfonyl-2-(4-methylphenyl)sulfonylacetohydrazide |
| SMILES | CCCCS(=O)(=O)NNC(=O)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H20N2O5S2/c1-3-4-9-22(19,20)15-14-13(16)10-21(17,18)12-7-5-11(2)6-8-12/h5-8,15H,3-4,9-10H2,1-2H3,(H,14,16) |
| InChIKey | PXZOISQUXYHIMW-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|