C18H22N4O6S2 — CID 5153632
1-N',4-N'-bis-(4-methylphenyl)sulfonylbutanedihydrazide (PubChem CID 5153632) has the molecular formula C18H22N4O6S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-N',4-N'-bis-(4-methylphenyl)sulfonylbutanedihydrazide.
| Compound Name | 1-N',4-N'-bis-(4-methylphenyl)sulfonylbutanedihydrazide |
|---|---|
| PubChem CID | 5153632 |
| Molecular Formula | C18H22N4O6S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-N',4-N'-bis-(4-methylphenyl)sulfonylbutanedihydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)CCC(=O)NNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22N4O6S2/c1-13-3-7-15(8-4-13)29(25,26)21-19-17(23)11-12-18(24)20-22-30(27,28)16-9-5-14(2)6-10-16/h3-10,21-22H,11-12H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | QLALXBQEMAGNTO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|