C15H13Cl3N2O4S — CID 165343411
N'-(4-methylphenyl)sulfonyl-2-(2,4,5-trichlorophenoxy)acetohydrazide (PubChem CID 165343411) has the molecular formula C15H13Cl3N2O4S and a molecular weight of 423.71 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-2-(2,4,5-trichlorophenoxy)acetohydrazide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-2-(2,4,5-trichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 165343411 |
| Molecular Formula | C15H13Cl3N2O4S |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-2-(2,4,5-trichlorophenoxy)acetohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)COc2cc(Cl)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl3N2O4S/c1-9-2-4-10(5-3-9)25(22,23)20-19-15(21)8-24-14-7-12(17)11(16)6-13(14)18/h2-7,20H,8H2,1H3,(H,19,21) |
| InChIKey | NLIANRYNXNXWFI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|