C17H19ClN2O5S — CID 9244388
2-(2-chloro-5-methylphenoxy)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide (PubChem CID 9244388) has the molecular formula C17H19ClN2O5S and a molecular weight of 398.87 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 9244388 |
| Molecular Formula | C17H19ClN2O5S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-N'-(4-ethoxyphenyl)sulfonylacetohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)COc2cc(C)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O5S/c1-3-24-13-5-7-14(8-6-13)26(22,23)20-19-17(21)11-25-16-10-12(2)4-9-15(16)18/h4-10,20H,3,11H2,1-2H3,(H,19,21) |
| InChIKey | OYCOAGJDHSVHPL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|