C17H20N2O5S — CID 7974521
N'-(4-ethoxyphenyl)sulfonyl-2-(2-methoxyphenyl)acetohydrazide (PubChem CID 7974521) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N'-(4-ethoxyphenyl)sulfonyl-2-(2-methoxyphenyl)acetohydrazide.
| Compound Name | N'-(4-ethoxyphenyl)sulfonyl-2-(2-methoxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 7974521 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N'-(4-ethoxyphenyl)sulfonyl-2-(2-methoxyphenyl)acetohydrazide |
| SMILES | CCOc1ccc(S(=O)(=O)NNC(=O)Cc2ccccc2OC)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-3-24-14-8-10-15(11-9-14)25(21,22)19-18-17(20)12-13-6-4-5-7-16(13)23-2/h4-11,19H,3,12H2,1-2H3,(H,18,20) |
| InChIKey | WBIQIIFAJDESDZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|