C15H15FN2O5S — CID 8614556
2-(2-fluorophenoxy)-N'-(4-methoxyphenyl)sulfonylacetohydrazide (PubChem CID 8614556) has the molecular formula C15H15FN2O5S and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N'-(4-methoxyphenyl)sulfonylacetohydrazide.
| Compound Name | 2-(2-fluorophenoxy)-N'-(4-methoxyphenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8614556 |
| Molecular Formula | C15H15FN2O5S |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-(2-fluorophenoxy)-N'-(4-methoxyphenyl)sulfonylacetohydrazide |
| SMILES | COc1ccc(S(=O)(=O)NNC(=O)COc2ccccc2F)cc1 |
| InChI | InChI=1S/C15H15FN2O5S/c1-22-11-6-8-12(9-7-11)24(20,21)18-17-15(19)10-23-14-5-3-2-4-13(14)16/h2-9,18H,10H2,1H3,(H,17,19) |
| InChIKey | RQYAVNIEOXISHJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|