C17H16FN3O5S — CID 8515699
2-(2-fluorophenoxy)-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]acetohydrazide (PubChem CID 8515699) has the molecular formula C17H16FN3O5S and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]acetohydrazide.
| Compound Name | 2-(2-fluorophenoxy)-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]acetohydrazide |
|---|---|
| PubChem CID | 8515699 |
| Molecular Formula | C17H16FN3O5S |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 2-(2-fluorophenoxy)-N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonyl]acetohydrazide |
| SMILES | O=C(COc1ccccc1F)NNS(=O)(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H16FN3O5S/c18-13-3-1-2-4-15(13)26-10-17(23)20-21-27(24,25)12-6-7-14-11(9-12)5-8-16(22)19-14/h1-4,6-7,9,21H,5,8,10H2,(H,19,22)(H,20,23) |
| InChIKey | MSSZTMAWUNMHHV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|