C15H13FN2O3S — CID 7601955
N-(2-fluorophenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 7601955) has the molecular formula C15H13FN2O3S and a molecular weight of 320.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | N-(2-fluorophenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 7601955 |
| Molecular Formula | C15H13FN2O3S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(2-fluorophenyl)-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | O=C1CCc2cc(S(=O)(=O)Nc3ccccc3F)ccc2N1 |
| InChI | InChI=1S/C15H13FN2O3S/c16-12-3-1-2-4-14(12)18-22(20,21)11-6-7-13-10(9-11)5-8-15(19)17-13/h1-4,6-7,9,18H,5,8H2,(H,17,19) |
| InChIKey | FXULHVBWXADQIT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |