C16H15N3O4S — CID 7586418
4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]benzamide (PubChem CID 7586418) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]benzamide.
| Compound Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 7586418 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]benzamide |
| SMILES | NC(=O)c1ccc(NS(=O)(=O)c2ccc3c(c2)CCC(=O)N3)cc1 |
| InChI | InChI=1S/C16H15N3O4S/c17-16(21)10-1-4-12(5-2-10)19-24(22,23)13-6-7-14-11(9-13)3-8-15(20)18-14/h1-2,4-7,9,19H,3,8H2,(H2,17,21)(H,18,20) |
| InChIKey | XWCVYHJVJDLLHZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |