C17H15N3O3S2 — CID 8516321
[3-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]phenyl] thiocyanate (PubChem CID 8516321) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is [3-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]phenyl] thiocyanate.
| Compound Name | [3-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 8516321 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | [3-methyl-4-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)sulfonylamino]phenyl] thiocyanate |
| SMILES | Cc1cc(SC#N)ccc1NS(=O)(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C17H15N3O3S2/c1-11-8-13(24-10-18)3-5-15(11)20-25(22,23)14-4-6-16-12(9-14)2-7-17(21)19-16/h3-6,8-9,20H,2,7H2,1H3,(H,19,21) |
| InChIKey | AXFAVHMQXDFGKW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|