C15H13FN2O2S2 — CID 7938413
[4-[(3,4-dimethylphenyl)sulfonylamino]-3-fluorophenyl] thiocyanate (PubChem CID 7938413) has the molecular formula C15H13FN2O2S2 and a molecular weight of 336.41 g/mol. Its IUPAC name is [4-[(3,4-dimethylphenyl)sulfonylamino]-3-fluorophenyl] thiocyanate.
| Compound Name | [4-[(3,4-dimethylphenyl)sulfonylamino]-3-fluorophenyl] thiocyanate |
|---|---|
| PubChem CID | 7938413 |
| Molecular Formula | C15H13FN2O2S2 |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | [4-[(3,4-dimethylphenyl)sulfonylamino]-3-fluorophenyl] thiocyanate |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(SC#N)cc2F)cc1C |
| InChI | InChI=1S/C15H13FN2O2S2/c1-10-3-5-13(7-11(10)2)22(19,20)18-15-6-4-12(21-9-17)8-14(15)16/h3-8,18H,1-2H3 |
| InChIKey | GNYOGNSBENUGSC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|