C15H13ClN2O2S — CID 103791853
N-(2-chloro-4-cyanophenyl)-3,4-dimethylbenzenesulfonamide (PubChem CID 103791853) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is N-(2-chloro-4-cyanophenyl)-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-(2-chloro-4-cyanophenyl)-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 103791853 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-(2-chloro-4-cyanophenyl)-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C#N)cc2Cl)cc1C |
| InChI | InChI=1S/C15H13ClN2O2S/c1-10-3-5-13(7-11(10)2)21(19,20)18-15-6-4-12(9-17)8-14(15)16/h3-8,18H,1-2H3 |
| InChIKey | XRIDOFRXLCBNNO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |