C12H10ClN5O2S — CID 107810157
N-(2-chloro-4-cyanophenyl)-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 107810157) has the molecular formula C12H10ClN5O2S and a molecular weight of 323.77 g/mol. Its IUPAC name is N-(2-chloro-4-cyanophenyl)-2-(methylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(2-chloro-4-cyanophenyl)-2-(methylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 107810157 |
| Molecular Formula | C12H10ClN5O2S |
| Molecular Weight | 323.77 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | N-(2-chloro-4-cyanophenyl)-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)Nc2ccc(C#N)cc2Cl)cn1 |
| InChI | InChI=1S/C12H10ClN5O2S/c1-15-12-16-6-9(7-17-12)21(19,20)18-11-3-2-8(5-14)4-10(11)13/h2-4,6-7,18H,1H3,(H,15,16,17) |
| InChIKey | FDOOWMUMTIWMOG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |